C16H18N4O4S — CID 119802695
[2-(aminomethyl)-1,3-thiazol-4-yl]-[4-(4-nitrophenoxy)piperidin-1-yl]methanone (PubChem CID 119802695) has the molecular formula C16H18N4O4S and a molecular weight of 362.41 g/mol. Its IUPAC name is [2-(aminomethyl)-1,3-thiazol-4-yl]-[4-(4-nitrophenoxy)piperidin-1-yl]methanone.
| Compound Name | [2-(aminomethyl)-1,3-thiazol-4-yl]-[4-(4-nitrophenoxy)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 119802695 |
| Molecular Formula | C16H18N4O4S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | [2-(aminomethyl)-1,3-thiazol-4-yl]-[4-(4-nitrophenoxy)piperidin-1-yl]methanone |
| SMILES | NCc1nc(C(=O)N2CCC(Oc3ccc([N+](=O)[O-])cc3)CC2)cs1 |
| InChI | InChI=1S/C16H18N4O4S/c17-9-15-18-14(10-25-15)16(21)19-7-5-13(6-8-19)24-12-3-1-11(2-4-12)20(22)23/h1-4,10,13H,5-9,17H2 |
| InChIKey | BDMVPKRYLGSXRB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 111.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|