C17H27ClN2O3S — CID 119802914
3-amino-2-methyl-N-(4-methylsulfonylcyclohexyl)-3-phenylpropanamide;hydrochloride (PubChem CID 119802914) has the molecular formula C17H27ClN2O3S and a molecular weight of 374.93 g/mol. Its IUPAC name is 3-amino-2-methyl-N-(4-methylsulfonylcyclohexyl)-3-phenylpropanamide;hydrochloride.
| Compound Name | 3-amino-2-methyl-N-(4-methylsulfonylcyclohexyl)-3-phenylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119802914 |
| Molecular Formula | C17H27ClN2O3S |
| Molecular Weight | 374.93 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 3-amino-2-methyl-N-(4-methylsulfonylcyclohexyl)-3-phenylpropanamide;hydrochloride |
| SMILES | CC(C(=O)NC1CCC(S(C)(=O)=O)CC1)C(N)c1ccccc1.Cl |
| InChI | InChI=1S/C17H26N2O3S.ClH/c1-12(16(18)13-6-4-3-5-7-13)17(20)19-14-8-10-15(11-9-14)23(2,21)22;/h3-7,12,14-16H,8-11,18H2,1-2H3,(H,19,20);1H |
| InChIKey | SIFGINYTEKNEIN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.93 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |