C15H25ClN2O2 — CID 119803631
1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl-(3-aminocyclohexyl)methanone;hydrochloride (PubChem CID 119803631) has the molecular formula C15H25ClN2O2 and a molecular weight of 300.83 g/mol. Its IUPAC name is 1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl-(3-aminocyclohexyl)methanone;hydrochloride.
| Compound Name | 1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl-(3-aminocyclohexyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119803631 |
| Molecular Formula | C15H25ClN2O2 |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl-(3-aminocyclohexyl)methanone;hydrochloride |
| SMILES | Cl.NC1CCCC(C(=O)N2CC3C4CCC(O4)C3C2)C1 |
| InChI | InChI=1S/C15H24N2O2.ClH/c16-10-3-1-2-9(6-10)15(18)17-7-11-12(8-17)14-5-4-13(11)19-14;/h9-14H,1-8,16H2;1H |
| InChIKey | PKMVXLTZIGZCHO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |