C17H27ClN2O2 — CID 119803643
1-(1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl)-2-(8-azabicyclo[3.2.1]octan-3-yl)ethanone;hydrochloride (PubChem CID 119803643) has the molecular formula C17H27ClN2O2 and a molecular weight of 326.87 g/mol. Its IUPAC name is 1-(1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl)-2-(8-azabicyclo[3.2.1]octan-3-yl)ethanone;hydrochloride.
| Compound Name | 1-(1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl)-2-(8-azabicyclo[3.2.1]octan-3-yl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 119803643 |
| Molecular Formula | C17H27ClN2O2 |
| Molecular Weight | 326.87 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 1-(1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl)-2-(8-azabicyclo[3.2.1]octan-3-yl)ethanone;hydrochloride |
| SMILES | Cl.O=C(CC1CC2CCC(C1)N2)N1CC2C3CCC(O3)C2C1 |
| InChI | InChI=1S/C17H26N2O2.ClH/c20-17(7-10-5-11-1-2-12(6-10)18-11)19-8-13-14(9-19)16-4-3-15(13)21-16;/h10-16,18H,1-9H2;1H |
| InChIKey | BOUYUNVBZYXMGM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.87 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |