C16H29ClN2O2 — CID 119803923
N-(2-cyclohexylcyclopropyl)-4-methoxypiperidine-4-carboxamide;hydrochloride (PubChem CID 119803923) has the molecular formula C16H29ClN2O2 and a molecular weight of 316.87 g/mol. Its IUPAC name is N-(2-cyclohexylcyclopropyl)-4-methoxypiperidine-4-carboxamide;hydrochloride.
| Compound Name | N-(2-cyclohexylcyclopropyl)-4-methoxypiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119803923 |
| Molecular Formula | C16H29ClN2O2 |
| Molecular Weight | 316.87 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | N-(2-cyclohexylcyclopropyl)-4-methoxypiperidine-4-carboxamide;hydrochloride |
| SMILES | COC1(C(=O)NC2CC2C2CCCCC2)CCNCC1.Cl |
| InChI | InChI=1S/C16H28N2O2.ClH/c1-20-16(7-9-17-10-8-16)15(19)18-14-11-13(14)12-5-3-2-4-6-12;/h12-14,17H,2-11H2,1H3,(H,18,19);1H |
| InChIKey | WHRVCHICUWDTHZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.87 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |