C16H29ClN2O3 — CID 119805200
N-(3-ethoxyspiro[3.5]nonan-1-yl)morpholine-2-carboxamide;hydrochloride (PubChem CID 119805200) has the molecular formula C16H29ClN2O3 and a molecular weight of 332.87 g/mol. Its IUPAC name is N-(3-ethoxyspiro[3.5]nonan-1-yl)morpholine-2-carboxamide;hydrochloride.
| Compound Name | N-(3-ethoxyspiro[3.5]nonan-1-yl)morpholine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119805200 |
| Molecular Formula | C16H29ClN2O3 |
| Molecular Weight | 332.87 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | N-(3-ethoxyspiro[3.5]nonan-1-yl)morpholine-2-carboxamide;hydrochloride |
| SMILES | CCOC1CC(NC(=O)C2CNCCO2)C12CCCCC2.Cl |
| InChI | InChI=1S/C16H28N2O3.ClH/c1-2-20-14-10-13(16(14)6-4-3-5-7-16)18-15(19)12-11-17-8-9-21-12;/h12-14,17H,2-11H2,1H3,(H,18,19);1H |
| InChIKey | KOILNCBPMHXMQF-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.87 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |