C20H26ClN3O2 — CID 119805525
N-[[4-(N-ethylanilino)phenyl]methyl]morpholine-2-carboxamide;hydrochloride (PubChem CID 119805525) has the molecular formula C20H26ClN3O2 and a molecular weight of 375.90 g/mol. Its IUPAC name is N-[[4-(N-ethylanilino)phenyl]methyl]morpholine-2-carboxamide;hydrochloride.
| Compound Name | N-[[4-(N-ethylanilino)phenyl]methyl]morpholine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119805525 |
| Molecular Formula | C20H26ClN3O2 |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | N-[[4-(N-ethylanilino)phenyl]methyl]morpholine-2-carboxamide;hydrochloride |
| SMILES | CCN(c1ccccc1)c1ccc(CNC(=O)C2CNCCO2)cc1.Cl |
| InChI | InChI=1S/C20H25N3O2.ClH/c1-2-23(17-6-4-3-5-7-17)18-10-8-16(9-11-18)14-22-20(24)19-15-21-12-13-25-19;/h3-11,19,21H,2,12-15H2,1H3,(H,22,24);1H |
| InChIKey | VXUBVUDSBCPQMB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |