C13H25ClN2O2S — CID 119805571
N-[(4-methylsulfanyloxan-4-yl)methyl]-2-pyrrolidin-2-ylacetamide;hydrochloride (PubChem CID 119805571) has the molecular formula C13H25ClN2O2S and a molecular weight of 308.88 g/mol. Its IUPAC name is N-[(4-methylsulfanyloxan-4-yl)methyl]-2-pyrrolidin-2-ylacetamide;hydrochloride.
| Compound Name | N-[(4-methylsulfanyloxan-4-yl)methyl]-2-pyrrolidin-2-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119805571 |
| Molecular Formula | C13H25ClN2O2S |
| Molecular Weight | 308.88 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | N-[(4-methylsulfanyloxan-4-yl)methyl]-2-pyrrolidin-2-ylacetamide;hydrochloride |
| SMILES | CSC1(CNC(=O)CC2CCCN2)CCOCC1.Cl |
| InChI | InChI=1S/C13H24N2O2S.ClH/c1-18-13(4-7-17-8-5-13)10-15-12(16)9-11-3-2-6-14-11;/h11,14H,2-10H2,1H3,(H,15,16);1H |
| InChIKey | UKHXJTQHRSGDBM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.88 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |