C18H28N4 — CID 11980616
N-[4-(1,2-dihydropyridin-4-ylmethylideneamino)cyclohexyl]-1-piperidin-4-ylmethanimine (PubChem CID 11980616) has the molecular formula C18H28N4 and a molecular weight of 300.45 g/mol. Its IUPAC name is N-[4-(1,2-dihydropyridin-4-ylmethylideneamino)cyclohexyl]-1-piperidin-4-ylmethanimine.
| Compound Name | N-[4-(1,2-dihydropyridin-4-ylmethylideneamino)cyclohexyl]-1-piperidin-4-ylmethanimine |
|---|---|
| PubChem CID | 11980616 |
| Molecular Formula | C18H28N4 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | N-[4-(1,2-dihydropyridin-4-ylmethylideneamino)cyclohexyl]-1-piperidin-4-ylmethanimine |
| SMILES | C1=CC(/C=N/C2CCC(/N=C/C3CCNCC3)CC2)=CCN1 |
| InChI | InChI=1S/C18H28N4/c1-2-18(22-14-16-7-11-20-12-8-16)4-3-17(1)21-13-15-5-9-19-10-6-15/h5-6,9,13-14,16-20H,1-4,7-8,10-12H2/b21-13+,22-14+ |
| InChIKey | DLRXFDRZWFRMLI-JFMUQQRKSA-N |
| XLogP | 2.48 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|