C18H25FN2O3 — CID 119806534
N-(4-cyclopentyloxy-3-fluorophenyl)-4-methoxypiperidine-4-carboxamide (PubChem CID 119806534) has the molecular formula C18H25FN2O3 and a molecular weight of 336.41 g/mol. Its IUPAC name is N-(4-cyclopentyloxy-3-fluorophenyl)-4-methoxypiperidine-4-carboxamide.
| Compound Name | N-(4-cyclopentyloxy-3-fluorophenyl)-4-methoxypiperidine-4-carboxamide |
|---|---|
| PubChem CID | 119806534 |
| Molecular Formula | C18H25FN2O3 |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | N-(4-cyclopentyloxy-3-fluorophenyl)-4-methoxypiperidine-4-carboxamide |
| SMILES | COC1(C(=O)Nc2ccc(OC3CCCC3)c(F)c2)CCNCC1 |
| InChI | InChI=1S/C18H25FN2O3/c1-23-18(8-10-20-11-9-18)17(22)21-13-6-7-16(15(19)12-13)24-14-4-2-3-5-14/h6-7,12,14,20H,2-5,8-11H2,1H3,(H,21,22) |
| InChIKey | CMZACIASBFZUDW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |