C33H27N9 — CID 11980743
2,4,6-tris[4-(imidazol-1-ylmethyl)phenyl]-1,3,5-triazine (PubChem CID 11980743) has the molecular formula C33H27N9 and a molecular weight of 549.64 g/mol. Its IUPAC name is 2,4,6-tris[4-(imidazol-1-ylmethyl)phenyl]-1,3,5-triazine.
| Compound Name | 2,4,6-tris[4-(imidazol-1-ylmethyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 11980743 |
| Molecular Formula | C33H27N9 |
| Molecular Weight | 549.64 g/mol |
| Exact Mass | 549.24 |
| IUPAC Name | 2,4,6-tris[4-(imidazol-1-ylmethyl)phenyl]-1,3,5-triazine |
| SMILES | c1cn(Cc2ccc(-c3nc(-c4ccc(Cn5ccnc5)cc4)nc(-c4ccc(Cn5ccnc5)cc4)n3)cc2)cn1 |
| InChI | InChI=1S/C33H27N9/c1-7-28(8-2-25(1)19-40-16-13-34-22-40)31-37-32(29-9-3-26(4-10-29)20-41-17-14-35-23-41)39-33(38-31)30-11-5-27(6-12-30)21-42-18-15-36-24-42/h1-18,22-24H,19-21H2 |
| InChIKey | WQGVRJDDMJKKBT-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 92.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.64 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |