C15H22ClFN2O2 — CID 119808982
3-amino-N-[3-(2-fluoroethoxy)phenyl]cyclohexane-1-carboxamide;hydrochloride (PubChem CID 119808982) has the molecular formula C15H22ClFN2O2 and a molecular weight of 316.80 g/mol. Its IUPAC name is 3-amino-N-[3-(2-fluoroethoxy)phenyl]cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 3-amino-N-[3-(2-fluoroethoxy)phenyl]cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119808982 |
| Molecular Formula | C15H22ClFN2O2 |
| Molecular Weight | 316.80 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 3-amino-N-[3-(2-fluoroethoxy)phenyl]cyclohexane-1-carboxamide;hydrochloride |
| SMILES | Cl.NC1CCCC(C(=O)Nc2cccc(OCCF)c2)C1 |
| InChI | InChI=1S/C15H21FN2O2.ClH/c16-7-8-20-14-6-2-5-13(10-14)18-15(19)11-3-1-4-12(17)9-11;/h2,5-6,10-12H,1,3-4,7-9,17H2,(H,18,19);1H |
| InChIKey | KHZICFUVAULEPR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.80 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |