About methyl 4-tert-butyl-2-(morpholine-3-carbonylamino)-1,3-thiazole-5-carboxylate;hydrochloride
methyl 4-tert-butyl-2-(morpholine-3-carbonylamino)-1,3-thiazole-5-carboxylate;hydrochloride (PubChem CID 119810039) has the molecular formula C14H22ClN3O4S
and a molecular weight of 363.87 g/mol. Its IUPAC name is methyl 4-tert-butyl-2-(morpholine-3-carbonylamino)-1,3-thiazole-5-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | methyl 4-tert-butyl-2-(morpholine-3-carbonylamino)-1,3-thiazole-5-carboxylate;hydrochloride |
| PubChem CID | 119810039 |
| Molecular Formula | C14H22ClN3O4S |
| Molecular Weight | 363.87 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | methyl 4-tert-butyl-2-(morpholine-3-carbonylamino)-1,3-thiazole-5-carboxylate;hydrochloride |
| SMILES | COC(=O)c1sc(NC(=O)C2COCCN2)nc1C(C)(C)C.Cl |
| InChI | InChI=1S/C14H21N3O4S.ClH/c1-14(2,3)10-9(12(19)20-4)22-13(16-10)17-11(18)8-7-21-6-5-15-8;/h8,15H,5-7H2,1-4H3,(H,16,17,18);1H |
| InChIKey | VUHYQDJBWGSWSP-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.87 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 4-tert-butyl-2-(morpholine-3-carbonylamino)-1,3-thiazole-5-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-tert-butyl-2-(morpholine-3-carbonylamino)-1,3-thiazole-5-carboxylate;hydrochloride?
The IUPAC name of methyl 4-tert-butyl-2-(morpholine-3-carbonylamino)-1,3-thiazole-5-carboxylate;hydrochloride (CID 119810039) is methyl 4-tert-butyl-2-(morpholine-3-carbonylamino)-1,3-thiazole-5-carboxylate;hydrochloride.
What is the SMILES notation for methyl 4-tert-butyl-2-(morpholine-3-carbonylamino)-1,3-thiazole-5-carboxylate;hydrochloride?
The canonical SMILES for methyl 4-tert-butyl-2-(morpholine-3-carbonylamino)-1,3-thiazole-5-carboxylate;hydrochloride is COC(=O)c1sc(NC(=O)C2COCCN2)nc1C(C)(C)C.Cl.
What is the InChIKey of methyl 4-tert-butyl-2-(morpholine-3-carbonylamino)-1,3-thiazole-5-carboxylate;hydrochloride?
The InChIKey is VUHYQDJBWGSWSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3O4S.ClH/c1-14(2,3)10-9(12(19)20-4)22-13(16-10)17-11(18)8-7-21-6-5-15-8;/h8,15H,5-7H2,1-4H3,(H,16,17,18);1H.
What are the key properties of methyl 4-tert-butyl-2-(morpholine-3-carbonylamino)-1,3-thiazole-5-carboxylate;hydrochloride?
methyl 4-tert-butyl-2-(morpholine-3-carbonylamino)-1,3-thiazole-5-carboxylate;hydrochloride has a molecular weight of 363.87 g/mol, XLogP of 1.58, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-tert-butyl-2-(morpholine-3-carbonylamino)-1,3-thiazole-5-carboxylate;hydrochloride is sourced from PubChem (CID 119810039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).