About 4-[5-methyl-2,4-bis[(3-nitrobenzoyl)amino]phenoxy]phthalic acid
4-[5-methyl-2,4-bis[(3-nitrobenzoyl)amino]phenoxy]phthalic acid (PubChem CID 11981200) has the molecular formula C29H20N4O11
and a molecular weight of 600.50 g/mol. Its IUPAC name is 4-[5-methyl-2,4-bis[(3-nitrobenzoyl)amino]phenoxy]phthalic acid.
Molecular Properties
| Compound Name | 4-[5-methyl-2,4-bis[(3-nitrobenzoyl)amino]phenoxy]phthalic acid |
| PubChem CID | 11981200 |
| Molecular Formula | C29H20N4O11 |
| Molecular Weight | 600.50 g/mol |
| Exact Mass | 600.11 |
| IUPAC Name | 4-[5-methyl-2,4-bis[(3-nitrobenzoyl)amino]phenoxy]phthalic acid |
| SMILES | Cc1cc(Oc2ccc(C(=O)O)c(C(=O)O)c2)c(NC(=O)c2cccc([N+](=O)[O-])c2)cc1NC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H20N4O11/c1-15-10-25(44-20-8-9-21(28(36)37)22(13-20)29(38)39)24(31-27(35)17-5-3-7-19(12-17)33(42)43)14-23(15)30-26(34)16-4-2-6-18(11-16)32(40)41/h2-14H,1H3,(H,30,34)(H,31,35)(H,36,37)(H,38,39) |
| InChIKey | PRDMNXIIPFRHPG-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 228.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 600.50 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[5-methyl-2,4-bis[(3-nitrobenzoyl)amino]phenoxy]phthalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-methyl-2,4-bis[(3-nitrobenzoyl)amino]phenoxy]phthalic acid?
The IUPAC name of 4-[5-methyl-2,4-bis[(3-nitrobenzoyl)amino]phenoxy]phthalic acid (CID 11981200) is 4-[5-methyl-2,4-bis[(3-nitrobenzoyl)amino]phenoxy]phthalic acid.
What is the SMILES notation for 4-[5-methyl-2,4-bis[(3-nitrobenzoyl)amino]phenoxy]phthalic acid?
The canonical SMILES for 4-[5-methyl-2,4-bis[(3-nitrobenzoyl)amino]phenoxy]phthalic acid is Cc1cc(Oc2ccc(C(=O)O)c(C(=O)O)c2)c(NC(=O)c2cccc([N+](=O)[O-])c2)cc1NC(=O)c1cccc([N+](=O)[O-])c1.
What is the InChIKey of 4-[5-methyl-2,4-bis[(3-nitrobenzoyl)amino]phenoxy]phthalic acid?
The InChIKey is PRDMNXIIPFRHPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H20N4O11/c1-15-10-25(44-20-8-9-21(28(36)37)22(13-20)29(38)39)24(31-27(35)17-5-3-7-19(12-17)33(42)43)14-23(15)30-26(34)16-4-2-6-18(11-16)32(40)41/h2-14H,1H3,(H,30,34)(H,31,35)(H,36,37)(H,38,39).
What are the key properties of 4-[5-methyl-2,4-bis[(3-nitrobenzoyl)amino]phenoxy]phthalic acid?
4-[5-methyl-2,4-bis[(3-nitrobenzoyl)amino]phenoxy]phthalic acid has a molecular weight of 600.50 g/mol, XLogP of 5.50, 10 rotatable bonds, 4 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-methyl-2,4-bis[(3-nitrobenzoyl)amino]phenoxy]phthalic acid is sourced from PubChem (CID 11981200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).