C16H33ClN2O2 — CID 119812179
(2S)-2-amino-N-[[1-(2-ethoxyethyl)cyclopentyl]methyl]-3,3-dimethylbutanamide;hydrochloride (PubChem CID 119812179) has the molecular formula C16H33ClN2O2 and a molecular weight of 320.91 g/mol. Its IUPAC name is (2S)-2-amino-N-[[1-(2-ethoxyethyl)cyclopentyl]methyl]-3,3-dimethylbutanamide;hydrochloride.
| Compound Name | (2S)-2-amino-N-[[1-(2-ethoxyethyl)cyclopentyl]methyl]-3,3-dimethylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119812179 |
| Molecular Formula | C16H33ClN2O2 |
| Molecular Weight | 320.91 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | (2S)-2-amino-N-[[1-(2-ethoxyethyl)cyclopentyl]methyl]-3,3-dimethylbutanamide;hydrochloride |
| SMILES | CCOCCC1(CNC(=O)[C@@H](N)C(C)(C)C)CCCC1.Cl |
| InChI | InChI=1S/C16H32N2O2.ClH/c1-5-20-11-10-16(8-6-7-9-16)12-18-14(19)13(17)15(2,3)4;/h13H,5-12,17H2,1-4H3,(H,18,19);1H/t13-;/m1./s1 |
| InChIKey | CVXIZLIBHSKXGH-BTQNPOSSSA-N |
| XLogP | 2.88 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.91 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|