About N-[[2-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]morpholine-3-carboxamide;hydrochloride
N-[[2-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]morpholine-3-carboxamide;hydrochloride (PubChem CID 119812800) has the molecular formula C17H23ClN4O2
and a molecular weight of 350.85 g/mol. Its IUPAC name is N-[[2-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]morpholine-3-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | N-[[2-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]morpholine-3-carboxamide;hydrochloride |
| PubChem CID | 119812800 |
| Molecular Formula | C17H23ClN4O2 |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | N-[[2-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]morpholine-3-carboxamide;hydrochloride |
| SMILES | Cc1cc(C)n(-c2ccccc2CNC(=O)C2COCCN2)n1.Cl |
| InChI | InChI=1S/C17H22N4O2.ClH/c1-12-9-13(2)21(20-12)16-6-4-3-5-14(16)10-19-17(22)15-11-23-8-7-18-15;/h3-6,9,15,18H,7-8,10-11H2,1-2H3,(H,19,22);1H |
| InChIKey | GJPHWJDIGMDZCE-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[[2-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]morpholine-3-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]morpholine-3-carboxamide;hydrochloride?
The IUPAC name of N-[[2-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]morpholine-3-carboxamide;hydrochloride (CID 119812800) is N-[[2-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]morpholine-3-carboxamide;hydrochloride.
What is the SMILES notation for N-[[2-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]morpholine-3-carboxamide;hydrochloride?
The canonical SMILES for N-[[2-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]morpholine-3-carboxamide;hydrochloride is Cc1cc(C)n(-c2ccccc2CNC(=O)C2COCCN2)n1.Cl.
What is the InChIKey of N-[[2-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]morpholine-3-carboxamide;hydrochloride?
The InChIKey is GJPHWJDIGMDZCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N4O2.ClH/c1-12-9-13(2)21(20-12)16-6-4-3-5-14(16)10-19-17(22)15-11-23-8-7-18-15;/h3-6,9,15,18H,7-8,10-11H2,1-2H3,(H,19,22);1H.
What are the key properties of N-[[2-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]morpholine-3-carboxamide;hydrochloride?
N-[[2-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]morpholine-3-carboxamide;hydrochloride has a molecular weight of 350.85 g/mol, XLogP of 1.52, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]morpholine-3-carboxamide;hydrochloride is sourced from PubChem (CID 119812800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).