C29H33FN8O4S — CID 11981347
N-[4-[4-amino-7-[4-(4-methylpiperazin-1-yl)cyclohexyl]pyrrolo[2,3-d]pyrimidin-5-yl]-2-fluorophenyl]-2-nitrobenzenesulfonamide (PubChem CID 11981347) has the molecular formula C29H33FN8O4S and a molecular weight of 608.70 g/mol. Its IUPAC name is N-[4-[4-amino-7-[4-(4-methylpiperazin-1-yl)cyclohexyl]pyrrolo[2,3-d]pyrimidin-5-yl]-2-fluorophenyl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[4-[4-amino-7-[4-(4-methylpiperazin-1-yl)cyclohexyl]pyrrolo[2,3-d]pyrimidin-5-yl]-2-fluorophenyl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 11981347 |
| Molecular Formula | C29H33FN8O4S |
| Molecular Weight | 608.70 g/mol |
| Exact Mass | 608.23 |
| IUPAC Name | N-[4-[4-amino-7-[4-(4-methylpiperazin-1-yl)cyclohexyl]pyrrolo[2,3-d]pyrimidin-5-yl]-2-fluorophenyl]-2-nitrobenzenesulfonamide |
| SMILES | CN1CCN(C2CCC(n3cc(-c4ccc(NS(=O)(=O)c5ccccc5[N+](=O)[O-])c(F)c4)c4c(N)ncnc43)CC2)CC1 |
| InChI | InChI=1S/C29H33FN8O4S/c1-35-12-14-36(15-13-35)20-7-9-21(10-8-20)37-17-22(27-28(31)32-18-33-29(27)37)19-6-11-24(23(30)16-19)34-43(41,42)26-5-3-2-4-25(26)38(39)40/h2-6,11,16-18,20-21,34H,7-10,12-15H2,1H3,(H2,31,32,33) |
| InChIKey | MBRRNTQDCPWMDB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 152.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.70 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|