About 2-amino-N-[1-(2,6-difluorophenyl)-2-oxopyrrolidin-3-yl]-2-methylpentanamide;hydrochloride
2-amino-N-[1-(2,6-difluorophenyl)-2-oxopyrrolidin-3-yl]-2-methylpentanamide;hydrochloride (PubChem CID 119814099) has the molecular formula C16H22ClF2N3O2
and a molecular weight of 361.82 g/mol. Its IUPAC name is 2-amino-N-[1-(2,6-difluorophenyl)-2-oxopyrrolidin-3-yl]-2-methylpentanamide;hydrochloride.
Molecular Properties
| Compound Name | 2-amino-N-[1-(2,6-difluorophenyl)-2-oxopyrrolidin-3-yl]-2-methylpentanamide;hydrochloride |
| PubChem CID | 119814099 |
| Molecular Formula | C16H22ClF2N3O2 |
| Molecular Weight | 361.82 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 2-amino-N-[1-(2,6-difluorophenyl)-2-oxopyrrolidin-3-yl]-2-methylpentanamide;hydrochloride |
| SMILES | CCCC(C)(N)C(=O)NC1CCN(c2c(F)cccc2F)C1=O.Cl |
| InChI | InChI=1S/C16H21F2N3O2.ClH/c1-3-8-16(2,19)15(23)20-12-7-9-21(14(12)22)13-10(17)5-4-6-11(13)18;/h4-6,12H,3,7-9,19H2,1-2H3,(H,20,23);1H |
| InChIKey | NFIRIURIVFMMEU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.82 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-N-[1-(2,6-difluorophenyl)-2-oxopyrrolidin-3-yl]-2-methylpentanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-[1-(2,6-difluorophenyl)-2-oxopyrrolidin-3-yl]-2-methylpentanamide;hydrochloride?
The IUPAC name of 2-amino-N-[1-(2,6-difluorophenyl)-2-oxopyrrolidin-3-yl]-2-methylpentanamide;hydrochloride (CID 119814099) is 2-amino-N-[1-(2,6-difluorophenyl)-2-oxopyrrolidin-3-yl]-2-methylpentanamide;hydrochloride.
What is the SMILES notation for 2-amino-N-[1-(2,6-difluorophenyl)-2-oxopyrrolidin-3-yl]-2-methylpentanamide;hydrochloride?
The canonical SMILES for 2-amino-N-[1-(2,6-difluorophenyl)-2-oxopyrrolidin-3-yl]-2-methylpentanamide;hydrochloride is CCCC(C)(N)C(=O)NC1CCN(c2c(F)cccc2F)C1=O.Cl.
What is the InChIKey of 2-amino-N-[1-(2,6-difluorophenyl)-2-oxopyrrolidin-3-yl]-2-methylpentanamide;hydrochloride?
The InChIKey is NFIRIURIVFMMEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21F2N3O2.ClH/c1-3-8-16(2,19)15(23)20-12-7-9-21(14(12)22)13-10(17)5-4-6-11(13)18;/h4-6,12H,3,7-9,19H2,1-2H3,(H,20,23);1H.
What are the key properties of 2-amino-N-[1-(2,6-difluorophenyl)-2-oxopyrrolidin-3-yl]-2-methylpentanamide;hydrochloride?
2-amino-N-[1-(2,6-difluorophenyl)-2-oxopyrrolidin-3-yl]-2-methylpentanamide;hydrochloride has a molecular weight of 361.82 g/mol, XLogP of 2.13, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-[1-(2,6-difluorophenyl)-2-oxopyrrolidin-3-yl]-2-methylpentanamide;hydrochloride is sourced from PubChem (CID 119814099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).