C16H25BrClFN2O — CID 119814208
7-amino-N-[1-(3-bromo-4-fluorophenyl)propan-2-yl]heptanamide;hydrochloride (PubChem CID 119814208) has the molecular formula C16H25BrClFN2O and a molecular weight of 395.74 g/mol. Its IUPAC name is 7-amino-N-[1-(3-bromo-4-fluorophenyl)propan-2-yl]heptanamide;hydrochloride.
| Compound Name | 7-amino-N-[1-(3-bromo-4-fluorophenyl)propan-2-yl]heptanamide;hydrochloride |
|---|---|
| PubChem CID | 119814208 |
| Molecular Formula | C16H25BrClFN2O |
| Molecular Weight | 395.74 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 7-amino-N-[1-(3-bromo-4-fluorophenyl)propan-2-yl]heptanamide;hydrochloride |
| SMILES | CC(Cc1ccc(F)c(Br)c1)NC(=O)CCCCCCN.Cl |
| InChI | InChI=1S/C16H24BrFN2O.ClH/c1-12(10-13-7-8-15(18)14(17)11-13)20-16(21)6-4-2-3-5-9-19;/h7-8,11-12H,2-6,9-10,19H2,1H3,(H,20,21);1H |
| InChIKey | DCMLMTHLTMIUEG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.74 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|