C76H70Cl4N8O10 — CID 11981550
N,N'-dibenzylethane-1,2-diamine;bis((2R)-3-[[4-[[N-[(3,5-dichlorophenyl)carbamoyl]-4-phenylanilino]methyl]benzoyl]amino]-2-hydroxypropanoic acid) (PubChem CID 11981550) has the molecular formula C76H70Cl4N8O10 and a molecular weight of 1397.25 g/mol. Its IUPAC name is N,N'-dibenzylethane-1,2-diamine;bis((2R)-3-[[4-[[N-[(3,5-dichlorophenyl)carbamoyl]-4-phenylanilino]methyl]benzoyl]amino]-2-hydroxypropanoic acid).
| Compound Name | N,N'-dibenzylethane-1,2-diamine;bis((2R)-3-[[4-[[N-[(3,5-dichlorophenyl)carbamoyl]-4-phenylanilino]methyl]benzoyl]amino]-2-hydroxypropanoic acid) |
|---|---|
| PubChem CID | 11981550 |
| Molecular Formula | C76H70Cl4N8O10 |
| Molecular Weight | 1397.25 g/mol |
| Exact Mass | 1394.40 |
| IUPAC Name | N,N'-dibenzylethane-1,2-diamine;bis((2R)-3-[[4-[[N-[(3,5-dichlorophenyl)carbamoyl]-4-phenylanilino]methyl]benzoyl]amino]-2-hydroxypropanoic acid) |
| SMILES | O=C(NC[C@@H](O)C(=O)O)c1ccc(CN(C(=O)Nc2cc(Cl)cc(Cl)c2)c2ccc(-c3ccccc3)cc2)cc1.O=C(NC[C@@H](O)C(=O)O)c1ccc(CN(C(=O)Nc2cc(Cl)cc(Cl)c2)c2ccc(-c3ccccc3)cc2)cc1.c1ccc(CNCCNCc2ccccc2)cc1 |
| InChI | InChI=1S/2C30H25Cl2N3O5.C16H20N2/c2*31-23-14-24(32)16-25(15-23)34-30(40)35(26-12-10-21(11-13-26)20-4-2-1-3-5-20)18-19-6-8-22(9-7-19)28(37)33-17-27(36)29(38)39;1-3-7-15(8-4-1)13-17-11-12-18-14-16-9-5-2-6-10-16/h2*1-16,27,36H,17-18H2,(H,33,37)(H,34,40)(H,38,39);1-10,17-18H,11-14H2/t2*27-;/m11./s1 |
| InChIKey | PDAWFTDCGABJPT-OFEQCWHFSA-N |
| XLogP | 14.71 |
| TPSA | 262.00 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 98 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1397.25 |
| LogP ≤ 5 | 14.71 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|