C14H8N6O6S2 — CID 11981572
N-phenyl-5-(2,4,6-trinitrophenyl)sulfanyl-1,3,4-thiadiazol-2-amine (PubChem CID 11981572) has the molecular formula C14H8N6O6S2 and a molecular weight of 420.39 g/mol. Its IUPAC name is N-phenyl-5-(2,4,6-trinitrophenyl)sulfanyl-1,3,4-thiadiazol-2-amine.
| Compound Name | N-phenyl-5-(2,4,6-trinitrophenyl)sulfanyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 11981572 |
| Molecular Formula | C14H8N6O6S2 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 419.99 |
| IUPAC Name | N-phenyl-5-(2,4,6-trinitrophenyl)sulfanyl-1,3,4-thiadiazol-2-amine |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(Sc2nnc(Nc3ccccc3)s2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H8N6O6S2/c21-18(22)9-6-10(19(23)24)12(11(7-9)20(25)26)27-14-17-16-13(28-14)15-8-4-2-1-3-5-8/h1-7H,(H,15,16) |
| InChIKey | LCLBAWGVMYATTD-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 167.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|