C18H20F2N2O — CID 119816053
3-amino-N-[1-(2,4-difluorophenyl)-2,2-dimethylpropyl]benzamide (PubChem CID 119816053) has the molecular formula C18H20F2N2O and a molecular weight of 318.37 g/mol. Its IUPAC name is 3-amino-N-[1-(2,4-difluorophenyl)-2,2-dimethylpropyl]benzamide.
| Compound Name | 3-amino-N-[1-(2,4-difluorophenyl)-2,2-dimethylpropyl]benzamide |
|---|---|
| PubChem CID | 119816053 |
| Molecular Formula | C18H20F2N2O |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 3-amino-N-[1-(2,4-difluorophenyl)-2,2-dimethylpropyl]benzamide |
| SMILES | CC(C)(C)C(NC(=O)c1cccc(N)c1)c1ccc(F)cc1F |
| InChI | InChI=1S/C18H20F2N2O/c1-18(2,3)16(14-8-7-12(19)10-15(14)20)22-17(23)11-5-4-6-13(21)9-11/h4-10,16H,21H2,1-3H3,(H,22,23) |
| InChIKey | OQJVKEYRLJRUBT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|