C20H26N2O2S — CID 119816673
3-amino-N-benzyl-N-(2-hydroxy-2-thiophen-2-ylethyl)cyclohexane-1-carboxamide (PubChem CID 119816673) has the molecular formula C20H26N2O2S and a molecular weight of 358.51 g/mol. Its IUPAC name is 3-amino-N-benzyl-N-(2-hydroxy-2-thiophen-2-ylethyl)cyclohexane-1-carboxamide.
| Compound Name | 3-amino-N-benzyl-N-(2-hydroxy-2-thiophen-2-ylethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 119816673 |
| Molecular Formula | C20H26N2O2S |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 3-amino-N-benzyl-N-(2-hydroxy-2-thiophen-2-ylethyl)cyclohexane-1-carboxamide |
| SMILES | NC1CCCC(C(=O)N(Cc2ccccc2)CC(O)c2cccs2)C1 |
| InChI | InChI=1S/C20H26N2O2S/c21-17-9-4-8-16(12-17)20(24)22(13-15-6-2-1-3-7-15)14-18(23)19-10-5-11-25-19/h1-3,5-7,10-11,16-18,23H,4,8-9,12-14,21H2 |
| InChIKey | QNRPIHCQYADXGW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |