C14H28ClN3O5S — CID 119818048
morpholin-3-yl-[4-(2-propan-2-yloxyethylsulfonyl)piperazin-1-yl]methanone;hydrochloride (PubChem CID 119818048) has the molecular formula C14H28ClN3O5S and a molecular weight of 385.91 g/mol. Its IUPAC name is morpholin-3-yl-[4-(2-propan-2-yloxyethylsulfonyl)piperazin-1-yl]methanone;hydrochloride.
| Compound Name | morpholin-3-yl-[4-(2-propan-2-yloxyethylsulfonyl)piperazin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119818048 |
| Molecular Formula | C14H28ClN3O5S |
| Molecular Weight | 385.91 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | morpholin-3-yl-[4-(2-propan-2-yloxyethylsulfonyl)piperazin-1-yl]methanone;hydrochloride |
| SMILES | CC(C)OCCS(=O)(=O)N1CCN(C(=O)C2COCCN2)CC1.Cl |
| InChI | InChI=1S/C14H27N3O5S.ClH/c1-12(2)22-9-10-23(19,20)17-6-4-16(5-7-17)14(18)13-11-21-8-3-15-13;/h12-13,15H,3-11H2,1-2H3;1H |
| InChIKey | MRQOVZBGRSSGFX-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.91 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |