C12H24ClN3O2 — CID 119818633
3-cyclohexyl-3-[[2-(methylamino)acetyl]amino]propanamide;hydrochloride (PubChem CID 119818633) has the molecular formula C12H24ClN3O2 and a molecular weight of 277.80 g/mol. Its IUPAC name is 3-cyclohexyl-3-[[2-(methylamino)acetyl]amino]propanamide;hydrochloride.
| Compound Name | 3-cyclohexyl-3-[[2-(methylamino)acetyl]amino]propanamide;hydrochloride |
|---|---|
| PubChem CID | 119818633 |
| Molecular Formula | C12H24ClN3O2 |
| Molecular Weight | 277.80 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 3-cyclohexyl-3-[[2-(methylamino)acetyl]amino]propanamide;hydrochloride |
| SMILES | CNCC(=O)NC(CC(N)=O)C1CCCCC1.Cl |
| InChI | InChI=1S/C12H23N3O2.ClH/c1-14-8-12(17)15-10(7-11(13)16)9-5-3-2-4-6-9;/h9-10,14H,2-8H2,1H3,(H2,13,16)(H,15,17);1H |
| InChIKey | NRDGXUSSLDKNEB-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.80 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |