C19H36N2O2 — CID 119819735
N-(3-ethoxy-2,2-diethylcyclobutyl)-3-piperidin-4-ylbutanamide (PubChem CID 119819735) has the molecular formula C19H36N2O2 and a molecular weight of 324.51 g/mol. Its IUPAC name is N-(3-ethoxy-2,2-diethylcyclobutyl)-3-piperidin-4-ylbutanamide.
| Compound Name | N-(3-ethoxy-2,2-diethylcyclobutyl)-3-piperidin-4-ylbutanamide |
|---|---|
| PubChem CID | 119819735 |
| Molecular Formula | C19H36N2O2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | N-(3-ethoxy-2,2-diethylcyclobutyl)-3-piperidin-4-ylbutanamide |
| SMILES | CCOC1CC(NC(=O)CC(C)C2CCNCC2)C1(CC)CC |
| InChI | InChI=1S/C19H36N2O2/c1-5-19(6-2)16(13-17(19)23-7-3)21-18(22)12-14(4)15-8-10-20-11-9-15/h14-17,20H,5-13H2,1-4H3,(H,21,22) |
| InChIKey | OACQGXACJYBCCY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |