About CID 11982085
CID 11982085 (PubChem CID 11982085) has the molecular formula C60H64N4O5
and a molecular weight of 921.19 g/mol.
Molecular Properties
| Compound Name | CID 11982085 |
| PubChem CID | 11982085 |
| Molecular Formula | C60H64N4O5 |
| Molecular Weight | 921.19 g/mol |
| Exact Mass | 920.49 |
| IUPAC Name | — |
| SMILES | Cc1cc2cc(C)c1NC(=O)c1cccc(c1)C(=O)Nc1c(C)cc(cc1C)C1(CCCCC1)c1cc(C)c(c(C)c1)NC(=O)c1cc(O)cc(c1)C(=O)Nc1c(C)cc(cc1C)C21CCCCC1 |
| InChI | InChI=1S/C60H64N4O5/c1-34-22-46-23-35(2)51(34)61-55(66)42-16-15-17-43(30-42)56(67)62-52-36(3)24-47(25-37(52)4)60(20-13-10-14-21-60)49-28-40(7)54(41(8)29-49)64-58(69)45-31-44(32-50(65)33-45)57(68)63-53-38(5)26-48(27-39(53)6)59(46)18-11-9-12-19-59/h15-17,22-33,65H,9-14,18-21H2,1-8H3,(H,61,66)(H,62,67)(H,63,68)(H,64,69) |
| InChIKey | OZMWXAQMCCYCLH-UHFFFAOYSA-N |
| XLogP | 13.68 |
| TPSA | 136.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 69 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 921.19 |
| LogP ≤ 5 | 13.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 11982085 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11982085?
The IUPAC name of CID 11982085 (CID 11982085) is not available.
What is the SMILES notation for CID 11982085?
The canonical SMILES for CID 11982085 is Cc1cc2cc(C)c1NC(=O)c1cccc(c1)C(=O)Nc1c(C)cc(cc1C)C1(CCCCC1)c1cc(C)c(c(C)c1)NC(=O)c1cc(O)cc(c1)C(=O)Nc1c(C)cc(cc1C)C21CCCCC1.
What is the InChIKey of CID 11982085?
The InChIKey is OZMWXAQMCCYCLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C60H64N4O5/c1-34-22-46-23-35(2)51(34)61-55(66)42-16-15-17-43(30-42)56(67)62-52-36(3)24-47(25-37(52)4)60(20-13-10-14-21-60)49-28-40(7)54(41(8)29-49)64-58(69)45-31-44(32-50(65)33-45)57(68)63-53-38(5)26-48(27-39(53)6)59(46)18-11-9-12-19-59/h15-17,22-33,65H,9-14,18-21H2,1-8H3,(H,61,66)(H,62,67)(H,63,68)(H,64,69).
What are the key properties of CID 11982085?
CID 11982085 has a molecular weight of 921.19 g/mol, XLogP of 13.68, 0 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11982085 is sourced from PubChem (CID 11982085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).