C17H25N3O3S — CID 119821858
3-amino-N-[[4-(ethylsulfamoyl)phenyl]methyl]bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 119821858) has the molecular formula C17H25N3O3S and a molecular weight of 351.47 g/mol. Its IUPAC name is 3-amino-N-[[4-(ethylsulfamoyl)phenyl]methyl]bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | 3-amino-N-[[4-(ethylsulfamoyl)phenyl]methyl]bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 119821858 |
| Molecular Formula | C17H25N3O3S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 3-amino-N-[[4-(ethylsulfamoyl)phenyl]methyl]bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | CCNS(=O)(=O)c1ccc(CNC(=O)C2C3CCC(C3)C2N)cc1 |
| InChI | InChI=1S/C17H25N3O3S/c1-2-20-24(22,23)14-7-3-11(4-8-14)10-19-17(21)15-12-5-6-13(9-12)16(15)18/h3-4,7-8,12-13,15-16,20H,2,5-6,9-10,18H2,1H3,(H,19,21) |
| InChIKey | YHXPCBJQYUWVRL-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |