C16H26ClFN2O2 — CID 119822525
2-amino-N-[4-(4-fluorophenyl)-4-hydroxybutan-2-yl]-2-methylpentanamide;hydrochloride (PubChem CID 119822525) has the molecular formula C16H26ClFN2O2 and a molecular weight of 332.85 g/mol. Its IUPAC name is 2-amino-N-[4-(4-fluorophenyl)-4-hydroxybutan-2-yl]-2-methylpentanamide;hydrochloride.
| Compound Name | 2-amino-N-[4-(4-fluorophenyl)-4-hydroxybutan-2-yl]-2-methylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 119822525 |
| Molecular Formula | C16H26ClFN2O2 |
| Molecular Weight | 332.85 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 2-amino-N-[4-(4-fluorophenyl)-4-hydroxybutan-2-yl]-2-methylpentanamide;hydrochloride |
| SMILES | CCCC(C)(N)C(=O)NC(C)CC(O)c1ccc(F)cc1.Cl |
| InChI | InChI=1S/C16H25FN2O2.ClH/c1-4-9-16(3,18)15(21)19-11(2)10-14(20)12-5-7-13(17)8-6-12;/h5-8,11,14,20H,4,9-10,18H2,1-3H3,(H,19,21);1H |
| InChIKey | TZUWAHPUJXPVJL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.85 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |