C17H27ClN2O — CID 119824323
3,5-dimethyl-N-piperidin-4-yl-N-propylbenzamide;hydrochloride (PubChem CID 119824323) has the molecular formula C17H27ClN2O and a molecular weight of 310.87 g/mol. Its IUPAC name is 3,5-dimethyl-N-piperidin-4-yl-N-propylbenzamide;hydrochloride.
| Compound Name | 3,5-dimethyl-N-piperidin-4-yl-N-propylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119824323 |
| Molecular Formula | C17H27ClN2O |
| Molecular Weight | 310.87 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 3,5-dimethyl-N-piperidin-4-yl-N-propylbenzamide;hydrochloride |
| SMILES | CCCN(C(=O)c1cc(C)cc(C)c1)C1CCNCC1.Cl |
| InChI | InChI=1S/C17H26N2O.ClH/c1-4-9-19(16-5-7-18-8-6-16)17(20)15-11-13(2)10-14(3)12-15;/h10-12,16,18H,4-9H2,1-3H3;1H |
| InChIKey | TUMFGWZKVIZXHX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.87 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |