C15H29ClN2O — CID 119824697
2-ethyl-2-methyl-N-piperidin-4-yl-N-propylcyclopropane-1-carboxamide;hydrochloride (PubChem CID 119824697) has the molecular formula C15H29ClN2O and a molecular weight of 288.86 g/mol. Its IUPAC name is 2-ethyl-2-methyl-N-piperidin-4-yl-N-propylcyclopropane-1-carboxamide;hydrochloride.
| Compound Name | 2-ethyl-2-methyl-N-piperidin-4-yl-N-propylcyclopropane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119824697 |
| Molecular Formula | C15H29ClN2O |
| Molecular Weight | 288.86 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 2-ethyl-2-methyl-N-piperidin-4-yl-N-propylcyclopropane-1-carboxamide;hydrochloride |
| SMILES | CCCN(C(=O)C1CC1(C)CC)C1CCNCC1.Cl |
| InChI | InChI=1S/C15H28N2O.ClH/c1-4-10-17(12-6-8-16-9-7-12)14(18)13-11-15(13,3)5-2;/h12-13,16H,4-11H2,1-3H3;1H |
| InChIKey | IPMGJAGEPRDEIU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.86 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |