C16H22F2N2OS — CID 119824836
4-(difluoromethylsulfanyl)-N-piperidin-4-yl-N-propylbenzamide (PubChem CID 119824836) has the molecular formula C16H22F2N2OS and a molecular weight of 328.43 g/mol. Its IUPAC name is 4-(difluoromethylsulfanyl)-N-piperidin-4-yl-N-propylbenzamide.
| Compound Name | 4-(difluoromethylsulfanyl)-N-piperidin-4-yl-N-propylbenzamide |
|---|---|
| PubChem CID | 119824836 |
| Molecular Formula | C16H22F2N2OS |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 4-(difluoromethylsulfanyl)-N-piperidin-4-yl-N-propylbenzamide |
| SMILES | CCCN(C(=O)c1ccc(SC(F)F)cc1)C1CCNCC1 |
| InChI | InChI=1S/C16H22F2N2OS/c1-2-11-20(13-7-9-19-10-8-13)15(21)12-3-5-14(6-4-12)22-16(17)18/h3-6,13,16,19H,2,7-11H2,1H3 |
| InChIKey | ZLQVRGLHZDEDRI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |