C37H34NO2P — CID 11982489
[2-[(4S,5S)-5-methyl-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]-1,3-diphenylpropan-2-yl]oxy-diphenylphosphane (PubChem CID 11982489) has the molecular formula C37H34NO2P and a molecular weight of 555.66 g/mol. Its IUPAC name is [2-[(4S,5S)-5-methyl-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]-1,3-diphenylpropan-2-yl]oxy-diphenylphosphane.
| Compound Name | [2-[(4S,5S)-5-methyl-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]-1,3-diphenylpropan-2-yl]oxy-diphenylphosphane |
|---|---|
| PubChem CID | 11982489 |
| Molecular Formula | C37H34NO2P |
| Molecular Weight | 555.66 g/mol |
| Exact Mass | 555.23 |
| IUPAC Name | [2-[(4S,5S)-5-methyl-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]-1,3-diphenylpropan-2-yl]oxy-diphenylphosphane |
| SMILES | C[C@@H]1OC(c2ccccc2)=N[C@@H]1C(Cc1ccccc1)(Cc1ccccc1)OP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H34NO2P/c1-29-35(38-36(39-29)32-21-11-4-12-22-32)37(27-30-17-7-2-8-18-30,28-31-19-9-3-10-20-31)40-41(33-23-13-5-14-24-33)34-25-15-6-16-26-34/h2-26,29,35H,27-28H2,1H3/t29-,35-/m0/s1 |
| InChIKey | WQHLVWNQNKIFPE-YTWZBVJHSA-N |
| XLogP | 7.51 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.66 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|