C20H25N3O2 — CID 119825107
4-phenoxy-N-piperidin-4-yl-N-propylpyridine-2-carboxamide (PubChem CID 119825107) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 4-phenoxy-N-piperidin-4-yl-N-propylpyridine-2-carboxamide.
| Compound Name | 4-phenoxy-N-piperidin-4-yl-N-propylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 119825107 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 4-phenoxy-N-piperidin-4-yl-N-propylpyridine-2-carboxamide |
| SMILES | CCCN(C(=O)c1cc(Oc2ccccc2)ccn1)C1CCNCC1 |
| InChI | InChI=1S/C20H25N3O2/c1-2-14-23(16-8-11-21-12-9-16)20(24)19-15-18(10-13-22-19)25-17-6-4-3-5-7-17/h3-7,10,13,15-16,21H,2,8-9,11-12,14H2,1H3 |
| InChIKey | UJJHNGIRPAYSIO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |