C19H27ClN4O — CID 119825262
5-methyl-1-phenyl-N-piperidin-4-yl-N-propylpyrazole-4-carboxamide;hydrochloride (PubChem CID 119825262) has the molecular formula C19H27ClN4O and a molecular weight of 362.90 g/mol. Its IUPAC name is 5-methyl-1-phenyl-N-piperidin-4-yl-N-propylpyrazole-4-carboxamide;hydrochloride.
| Compound Name | 5-methyl-1-phenyl-N-piperidin-4-yl-N-propylpyrazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119825262 |
| Molecular Formula | C19H27ClN4O |
| Molecular Weight | 362.90 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 5-methyl-1-phenyl-N-piperidin-4-yl-N-propylpyrazole-4-carboxamide;hydrochloride |
| SMILES | CCCN(C(=O)c1cnn(-c2ccccc2)c1C)C1CCNCC1.Cl |
| InChI | InChI=1S/C19H26N4O.ClH/c1-3-13-22(16-9-11-20-12-10-16)19(24)18-14-21-23(15(18)2)17-7-5-4-6-8-17;/h4-8,14,16,20H,3,9-13H2,1-2H3;1H |
| InChIKey | KMUPHOAYFWDBJF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.90 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |