C38H36N4O6 — CID 11982615
7,22-bis(prop-2-enoxy)-3,11,18,26-tetrazapentacyclo[26.2.2.213,16.15,9.120,24]hexatriaconta-1(31),5(36),6,8,13,15,20,22,24(33),28(32),29,34-dodecaene-4,10,19,25-tetrone (PubChem CID 11982615) has the molecular formula C38H36N4O6 and a molecular weight of 644.73 g/mol. Its IUPAC name is 7,22-bis(prop-2-enoxy)-3,11,18,26-tetrazapentacyclo[26.2.2.213,16.15,9.120,24]hexatriaconta-1(31),5(36),6,8,13,15,20,22,24(33),28(32),29,34-dodecaene-4,10,19,25-tetrone.
| Compound Name | 7,22-bis(prop-2-enoxy)-3,11,18,26-tetrazapentacyclo[26.2.2.213,16.15,9.120,24]hexatriaconta-1(31),5(36),6,8,13,15,20,22,24(33),28(32),29,34-dodecaene-4,10,19,25-tetrone |
|---|---|
| PubChem CID | 11982615 |
| Molecular Formula | C38H36N4O6 |
| Molecular Weight | 644.73 g/mol |
| Exact Mass | 644.26 |
| IUPAC Name | 7,22-bis(prop-2-enoxy)-3,11,18,26-tetrazapentacyclo[26.2.2.213,16.15,9.120,24]hexatriaconta-1(31),5(36),6,8,13,15,20,22,24(33),28(32),29,34-dodecaene-4,10,19,25-tetrone |
| SMILES | C=CCOc1cc2cc(c1)C(=O)NCc1ccc(cc1)CNC(=O)c1cc(OCC=C)cc(c1)C(=O)NCc1ccc(cc1)CNC2=O |
| InChI | InChI=1S/C38H36N4O6/c1-3-13-47-33-17-29-15-30(18-33)36(44)40-22-26-7-11-28(12-8-26)24-42-38(46)32-16-31(19-34(20-32)48-14-4-2)37(45)41-23-27-9-5-25(6-10-27)21-39-35(29)43/h3-12,15-20H,1-2,13-14,21-24H2,(H,39,43)(H,40,44)(H,41,45)(H,42,46) |
| InChIKey | OQBPLXOHLARUKG-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.73 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|