C10H17Cl2N3O2 — CID 119827132
2-(2-methoxyethylamino)-N-pyridin-4-ylacetamide;dihydrochloride (PubChem CID 119827132) has the molecular formula C10H17Cl2N3O2 and a molecular weight of 282.17 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-N-pyridin-4-ylacetamide;dihydrochloride.
| Compound Name | 2-(2-methoxyethylamino)-N-pyridin-4-ylacetamide;dihydrochloride |
|---|---|
| PubChem CID | 119827132 |
| Molecular Formula | C10H17Cl2N3O2 |
| Molecular Weight | 282.17 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 2-(2-methoxyethylamino)-N-pyridin-4-ylacetamide;dihydrochloride |
| SMILES | COCCNCC(=O)Nc1ccncc1.Cl.Cl |
| InChI | InChI=1S/C10H15N3O2.2ClH/c1-15-7-6-12-8-10(14)13-9-2-4-11-5-3-9;;/h2-5,12H,6-8H2,1H3,(H,11,13,14);2*1H |
| InChIKey | ZVAZHZPRYOEEBR-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.17 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|