C11H17Cl2N3O — CID 119827153
2-(cyclopropylmethylamino)-N-pyridin-3-ylacetamide;dihydrochloride (PubChem CID 119827153) has the molecular formula C11H17Cl2N3O and a molecular weight of 278.18 g/mol. Its IUPAC name is 2-(cyclopropylmethylamino)-N-pyridin-3-ylacetamide;dihydrochloride.
| Compound Name | 2-(cyclopropylmethylamino)-N-pyridin-3-ylacetamide;dihydrochloride |
|---|---|
| PubChem CID | 119827153 |
| Molecular Formula | C11H17Cl2N3O |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 2-(cyclopropylmethylamino)-N-pyridin-3-ylacetamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(CNCC1CC1)Nc1cccnc1 |
| InChI | InChI=1S/C11H15N3O.2ClH/c15-11(8-13-6-9-3-4-9)14-10-2-1-5-12-7-10;;/h1-2,5,7,9,13H,3-4,6,8H2,(H,14,15);2*1H |
| InChIKey | MXDAMWVDNNOTNW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |