C12H19Cl2N3O2 — CID 119827893
N-(2-pyridin-2-ylethyl)morpholine-3-carboxamide;dihydrochloride (PubChem CID 119827893) has the molecular formula C12H19Cl2N3O2 and a molecular weight of 308.21 g/mol. Its IUPAC name is N-(2-pyridin-2-ylethyl)morpholine-3-carboxamide;dihydrochloride.
| Compound Name | N-(2-pyridin-2-ylethyl)morpholine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119827893 |
| Molecular Formula | C12H19Cl2N3O2 |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | N-(2-pyridin-2-ylethyl)morpholine-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCCc1ccccn1)C1COCCN1 |
| InChI | InChI=1S/C12H17N3O2.2ClH/c16-12(11-9-17-8-7-14-11)15-6-4-10-3-1-2-5-13-10;;/h1-3,5,11,14H,4,6-9H2,(H,15,16);2*1H |
| InChIKey | CGPZWEQKVCUCTB-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |