C18H23Cl2N3O — CID 119828990
N-[4-(pyridin-4-ylmethyl)phenyl]-2-pyrrolidin-2-ylacetamide;dihydrochloride (PubChem CID 119828990) has the molecular formula C18H23Cl2N3O and a molecular weight of 368.31 g/mol. Its IUPAC name is N-[4-(pyridin-4-ylmethyl)phenyl]-2-pyrrolidin-2-ylacetamide;dihydrochloride.
| Compound Name | N-[4-(pyridin-4-ylmethyl)phenyl]-2-pyrrolidin-2-ylacetamide;dihydrochloride |
|---|---|
| PubChem CID | 119828990 |
| Molecular Formula | C18H23Cl2N3O |
| Molecular Weight | 368.31 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | N-[4-(pyridin-4-ylmethyl)phenyl]-2-pyrrolidin-2-ylacetamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(CC1CCCN1)Nc1ccc(Cc2ccncc2)cc1 |
| InChI | InChI=1S/C18H21N3O.2ClH/c22-18(13-17-2-1-9-20-17)21-16-5-3-14(4-6-16)12-15-7-10-19-11-8-15;;/h3-8,10-11,17,20H,1-2,9,12-13H2,(H,21,22);2*1H |
| InChIKey | VHPRNDQQTIIDPZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.31 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |