C15H24Cl3N3O — CID 119829106
3-amino-1-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]butan-1-one;dihydrochloride (PubChem CID 119829106) has the molecular formula C15H24Cl3N3O and a molecular weight of 368.74 g/mol. Its IUPAC name is 3-amino-1-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]butan-1-one;dihydrochloride.
| Compound Name | 3-amino-1-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]butan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 119829106 |
| Molecular Formula | C15H24Cl3N3O |
| Molecular Weight | 368.74 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 3-amino-1-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]butan-1-one;dihydrochloride |
| SMILES | Cc1ccc(Cl)cc1N1CCN(C(=O)CC(C)N)CC1.Cl.Cl |
| InChI | InChI=1S/C15H22ClN3O.2ClH/c1-11-3-4-13(16)10-14(11)18-5-7-19(8-6-18)15(20)9-12(2)17;;/h3-4,10,12H,5-9,17H2,1-2H3;2*1H |
| InChIKey | UZIHTWPOZLTNLG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.74 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |