C21H29Cl2N3O3 — CID 119829747
2-(4-aminophenyl)-N-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]acetamide;dihydrochloride (PubChem CID 119829747) has the molecular formula C21H29Cl2N3O3 and a molecular weight of 442.39 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]acetamide;dihydrochloride.
| Compound Name | 2-(4-aminophenyl)-N-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119829747 |
| Molecular Formula | C21H29Cl2N3O3 |
| Molecular Weight | 442.39 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 2-(4-aminophenyl)-N-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]acetamide;dihydrochloride |
| SMILES | COc1ccc(C(CNC(=O)Cc2ccc(N)cc2)N2CCOCC2)cc1.Cl.Cl |
| InChI | InChI=1S/C21H27N3O3.2ClH/c1-26-19-8-4-17(5-9-19)20(24-10-12-27-13-11-24)15-23-21(25)14-16-2-6-18(22)7-3-16;;/h2-9,20H,10-15,22H2,1H3,(H,23,25);2*1H |
| InChIKey | WSUOQKARPRPQBO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|