C17H27N3OS — CID 119830029
N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 119830029) has the molecular formula C17H27N3OS and a molecular weight of 321.49 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 119830029 |
| Molecular Formula | C17H27N3OS |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | CN(C)C(CNC(=O)C1CC2CCCCC2N1)c1cccs1 |
| InChI | InChI=1S/C17H27N3OS/c1-20(2)15(16-8-5-9-22-16)11-18-17(21)14-10-12-6-3-4-7-13(12)19-14/h5,8-9,12-15,19H,3-4,6-7,10-11H2,1-2H3,(H,18,21) |
| InChIKey | YZNXKUNOKXSZQX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |