C19H22Cl2N4O — CID 119832390
N-[3-(1H-benzimidazol-2-yl)phenyl]piperidine-4-carboxamide;dihydrochloride (PubChem CID 119832390) has the molecular formula C19H22Cl2N4O and a molecular weight of 393.32 g/mol. Its IUPAC name is N-[3-(1H-benzimidazol-2-yl)phenyl]piperidine-4-carboxamide;dihydrochloride.
| Compound Name | N-[3-(1H-benzimidazol-2-yl)phenyl]piperidine-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119832390 |
| Molecular Formula | C19H22Cl2N4O |
| Molecular Weight | 393.32 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | N-[3-(1H-benzimidazol-2-yl)phenyl]piperidine-4-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(Nc1cccc(-c2nc3ccccc3[nH]2)c1)C1CCNCC1 |
| InChI | InChI=1S/C19H20N4O.2ClH/c24-19(13-8-10-20-11-9-13)21-15-5-3-4-14(12-15)18-22-16-6-1-2-7-17(16)23-18;;/h1-7,12-13,20H,8-11H2,(H,21,24)(H,22,23);2*1H |
| InChIKey | WAFBYRXCRWIPDU-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.32 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |