C13H15F3N2 — CID 11983273
(3aS,6aS)-1-[3-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole (PubChem CID 11983273) has the molecular formula C13H15F3N2 and a molecular weight of 256.27 g/mol. Its IUPAC name is (3aS,6aS)-1-[3-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole.
| Compound Name | (3aS,6aS)-1-[3-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 11983273 |
| Molecular Formula | C13H15F3N2 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | (3aS,6aS)-1-[3-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole |
| SMILES | FC(F)(F)c1cccc(N2CC[C@H]3CNC[C@H]32)c1 |
| InChI | InChI=1S/C13H15F3N2/c14-13(15,16)10-2-1-3-11(6-10)18-5-4-9-7-17-8-12(9)18/h1-3,6,9,12,17H,4-5,7-8H2/t9-,12+/m0/s1 |
| InChIKey | ZEFKXSVTCBAESN-JOYOIKCWSA-N |
| XLogP | 2.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |