C17H26BrCl2N3O2 — CID 119833773
3-amino-N-(5-bromo-2-morpholin-4-ylphenyl)cyclohexane-1-carboxamide;dihydrochloride (PubChem CID 119833773) has the molecular formula C17H26BrCl2N3O2 and a molecular weight of 455.22 g/mol. Its IUPAC name is 3-amino-N-(5-bromo-2-morpholin-4-ylphenyl)cyclohexane-1-carboxamide;dihydrochloride.
| Compound Name | 3-amino-N-(5-bromo-2-morpholin-4-ylphenyl)cyclohexane-1-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119833773 |
| Molecular Formula | C17H26BrCl2N3O2 |
| Molecular Weight | 455.22 g/mol |
| Exact Mass | 453.06 |
| IUPAC Name | 3-amino-N-(5-bromo-2-morpholin-4-ylphenyl)cyclohexane-1-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NC1CCCC(C(=O)Nc2cc(Br)ccc2N2CCOCC2)C1 |
| InChI | InChI=1S/C17H24BrN3O2.2ClH/c18-13-4-5-16(21-6-8-23-9-7-21)15(11-13)20-17(22)12-2-1-3-14(19)10-12;;/h4-5,11-12,14H,1-3,6-10,19H2,(H,20,22);2*1H |
| InChIKey | YNNAWDKKYNZFIA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.22 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |