C18H26N4O2 — CID 119833975
2-[4-[4-(aminomethyl)benzoyl]piperazin-1-yl]-1-pyrrolidin-1-ylethanone (PubChem CID 119833975) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 2-[4-[4-(aminomethyl)benzoyl]piperazin-1-yl]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[4-[4-(aminomethyl)benzoyl]piperazin-1-yl]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 119833975 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 2-[4-[4-(aminomethyl)benzoyl]piperazin-1-yl]-1-pyrrolidin-1-ylethanone |
| SMILES | NCc1ccc(C(=O)N2CCN(CC(=O)N3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C18H26N4O2/c19-13-15-3-5-16(6-4-15)18(24)22-11-9-20(10-12-22)14-17(23)21-7-1-2-8-21/h3-6H,1-2,7-14,19H2 |
| InChIKey | ZKROZPOMEUNSOS-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |