C15H26Cl2N4O — CID 119834044
N-methyl-N-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride (PubChem CID 119834044) has the molecular formula C15H26Cl2N4O and a molecular weight of 349.31 g/mol. Its IUPAC name is N-methyl-N-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride.
| Compound Name | N-methyl-N-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119834044 |
| Molecular Formula | C15H26Cl2N4O |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | N-methyl-N-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride |
| SMILES | CN(Cc1cnn(C)c1)C(=O)C1CC2CCCCC2N1.Cl.Cl |
| InChI | InChI=1S/C15H24N4O.2ClH/c1-18(9-11-8-16-19(2)10-11)15(20)14-7-12-5-3-4-6-13(12)17-14;;/h8,10,12-14,17H,3-7,9H2,1-2H3;2*1H |
| InChIKey | HQBZUMWLUJMRHC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |