C18H26Cl2N4O — CID 119834520
N-[1-(1H-benzimidazol-2-yl)ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride (PubChem CID 119834520) has the molecular formula C18H26Cl2N4O and a molecular weight of 385.34 g/mol. Its IUPAC name is N-[1-(1H-benzimidazol-2-yl)ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride.
| Compound Name | N-[1-(1H-benzimidazol-2-yl)ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119834520 |
| Molecular Formula | C18H26Cl2N4O |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | N-[1-(1H-benzimidazol-2-yl)ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride |
| SMILES | CC(NC(=O)C1CC2CCCCC2N1)c1nc2ccccc2[nH]1.Cl.Cl |
| InChI | InChI=1S/C18H24N4O.2ClH/c1-11(17-21-14-8-4-5-9-15(14)22-17)19-18(23)16-10-12-6-2-3-7-13(12)20-16;;/h4-5,8-9,11-13,16,20H,2-3,6-7,10H2,1H3,(H,19,23)(H,21,22);2*1H |
| InChIKey | JZLXNFKOFAMTRN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |