C16H24Cl2N4O — CID 119834834
3-amino-N-[(1-methylbenzimidazol-2-yl)methyl]cyclohexane-1-carboxamide;dihydrochloride (PubChem CID 119834834) has the molecular formula C16H24Cl2N4O and a molecular weight of 359.30 g/mol. Its IUPAC name is 3-amino-N-[(1-methylbenzimidazol-2-yl)methyl]cyclohexane-1-carboxamide;dihydrochloride.
| Compound Name | 3-amino-N-[(1-methylbenzimidazol-2-yl)methyl]cyclohexane-1-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119834834 |
| Molecular Formula | C16H24Cl2N4O |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 3-amino-N-[(1-methylbenzimidazol-2-yl)methyl]cyclohexane-1-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.Cn1c(CNC(=O)C2CCCC(N)C2)nc2ccccc21 |
| InChI | InChI=1S/C16H22N4O.2ClH/c1-20-14-8-3-2-7-13(14)19-15(20)10-18-16(21)11-5-4-6-12(17)9-11;;/h2-3,7-8,11-12H,4-6,9-10,17H2,1H3,(H,18,21);2*1H |
| InChIKey | AGYYMEUDMOVLKK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |